Short Name | Poly(lactide-co-glycolide) star, glucose core, hydroxyl terminated vaccine adjuvant |
Description | Poly(lactide-co-glycolide) (PLGA) is a random copolymer with physical and mechanical properties that can be easily tuned by altering the lactide to glycolide ratio |
Storage | RT |
Shelf-life | 6 months |
Form | Solid |
Molecular Formula | C6H7O6((((C3H4O2)x(C2H2O2)y)m)H)5 |
Usage | TLR 3agonist |
Required fields are marked with *
×Catalog: CDAD24-001-T
Catalog: CDAD24-002-T
Catalog: CDAD24-003-T
Catalog: CDAD24-004-T
Catalog: CDAD24-005-T
Catalog: CDAD24-006-T
Catalog: CDAD24-007-T
Catalog: CDAD24-008-T